C23H23F3N2OS — CID 11561076
N-(2-benzylsulfanylethyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 11561076) has the molecular formula C23H23F3N2OS and a molecular weight of 432.51 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11561076 |
| Molecular Formula | C23H23F3N2OS |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCSCc2ccccc2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H23F3N2OS/c1-16-14-19(22(29)27-12-13-30-15-18-8-4-3-5-9-18)17(2)28(16)21-11-7-6-10-20(21)23(24,25)26/h3-11,14H,12-13,15H2,1-2H3,(H,27,29) |
| InChIKey | OQKYANLEDCBHKL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|