C18H23N3O2 — CID 167775581
N-(2-acetamidoethyl)-2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carboxamide (PubChem CID 167775581) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 167775581 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(2-acetamidoethyl)-2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cc(C)n(-c2ccccc2C)c1C |
| InChI | InChI=1S/C18H23N3O2/c1-12-7-5-6-8-17(12)21-13(2)11-16(14(21)3)18(23)20-10-9-19-15(4)22/h5-8,11H,9-10H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | BYSICKKIRAMRNU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|