C19H26ClN3O — CID 119390059
2,5-dimethyl-1-(2-methylphenyl)-N-piperidin-4-ylpyrrole-3-carboxamide;hydrochloride (PubChem CID 119390059) has the molecular formula C19H26ClN3O and a molecular weight of 347.89 g/mol. Its IUPAC name is 2,5-dimethyl-1-(2-methylphenyl)-N-piperidin-4-ylpyrrole-3-carboxamide;hydrochloride.
| Compound Name | 2,5-dimethyl-1-(2-methylphenyl)-N-piperidin-4-ylpyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119390059 |
| Molecular Formula | C19H26ClN3O |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2,5-dimethyl-1-(2-methylphenyl)-N-piperidin-4-ylpyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)NC2CCNCC2)c1C.Cl |
| InChI | InChI=1S/C19H25N3O.ClH/c1-13-6-4-5-7-18(13)22-14(2)12-17(15(22)3)19(23)21-16-8-10-20-11-9-16;/h4-7,12,16,20H,8-11H2,1-3H3,(H,21,23);1H |
| InChIKey | MNSSXLVCBFHOGL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|