C18H24ClN3O — CID 119453913
2,5-dimethyl-1-(2-methylphenyl)-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride (PubChem CID 119453913) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 2,5-dimethyl-1-(2-methylphenyl)-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride.
| Compound Name | 2,5-dimethyl-1-(2-methylphenyl)-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119453913 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2,5-dimethyl-1-(2-methylphenyl)-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)NC2CCNC2)c1C.Cl |
| InChI | InChI=1S/C18H23N3O.ClH/c1-12-6-4-5-7-17(12)21-13(2)10-16(14(21)3)18(22)20-15-8-9-19-11-15;/h4-7,10,15,19H,8-9,11H2,1-3H3,(H,20,22);1H |
| InChIKey | QXERVUGFFHRTQS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|