C17H21BrClN3O — CID 119453392
1-(3-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride (PubChem CID 119453392) has the molecular formula C17H21BrClN3O and a molecular weight of 398.73 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride.
| Compound Name | 1-(3-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119453392 |
| Molecular Formula | C17H21BrClN3O |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1-(3-bromophenyl)-2,5-dimethyl-N-pyrrolidin-3-ylpyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NC2CCNC2)c(C)n1-c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C17H20BrN3O.ClH/c1-11-8-16(17(22)20-14-6-7-19-10-14)12(2)21(11)15-5-3-4-13(18)9-15;/h3-5,8-9,14,19H,6-7,10H2,1-2H3,(H,20,22);1H |
| InChIKey | ZRZUPBGKSSRKPM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|