C21H27BrN4O2 — CID 52710868
1-(3-bromophenyl)-2,5-dimethyl-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyrrole-3-carboxamide (PubChem CID 52710868) has the molecular formula C21H27BrN4O2 and a molecular weight of 447.38 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,5-dimethyl-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyrrole-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 52710868 |
| Molecular Formula | C21H27BrN4O2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-(3-bromophenyl)-2,5-dimethyl-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyrrole-3-carboxamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)c2cc(C)n(-c3cccc(Br)c3)c2C)CC1 |
| InChI | InChI=1S/C21H27BrN4O2/c1-14-11-19(15(2)26(14)18-6-4-5-16(22)12-18)21(28)24-17-7-9-25(10-8-17)13-20(27)23-3/h4-6,11-12,17H,7-10,13H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | DDYPPSJVIZTEBL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|