C27H33N3O3 — CID 55978323
1-(4-methoxyphenyl)-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55978323) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55978323 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)NC3CCN(Cc4ccccc4OC)CC3)c2C)cc1 |
| InChI | InChI=1S/C27H33N3O3/c1-19-17-25(20(2)30(19)23-9-11-24(32-3)12-10-23)27(31)28-22-13-15-29(16-14-22)18-21-7-5-6-8-26(21)33-4/h5-12,17,22H,13-16,18H2,1-4H3,(H,28,31) |
| InChIKey | BSFQXUKOFJLXOR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|