C23H29N3O7 — CID 55951861
3,4,5-trimethoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-nitrobenzamide (PubChem CID 55951861) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-nitrobenzamide.
| Compound Name | 3,4,5-trimethoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 55951861 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3,4,5-trimethoxy-N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-2-nitrobenzamide |
| SMILES | COc1ccccc1CN1CCC(NC(=O)c2cc(OC)c(OC)c(OC)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H29N3O7/c1-30-18-8-6-5-7-15(18)14-25-11-9-16(10-12-25)24-23(27)17-13-19(31-2)21(32-3)22(33-4)20(17)26(28)29/h5-8,13,16H,9-12,14H2,1-4H3,(H,24,27) |
| InChIKey | YMBNRDOPNXZCAH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|