C21H25IN2O3 — CID 15167711
N-(1-benzylpiperidin-4-yl)-5-iodo-2,3-dimethoxybenzamide (PubChem CID 15167711) has the molecular formula C21H25IN2O3 and a molecular weight of 480.35 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-iodo-2,3-dimethoxybenzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-iodo-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 15167711 |
| Molecular Formula | C21H25IN2O3 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-iodo-2,3-dimethoxybenzamide |
| SMILES | COc1cc(I)cc(C(=O)NC2CCN(Cc3ccccc3)CC2)c1OC |
| InChI | InChI=1S/C21H25IN2O3/c1-26-19-13-16(22)12-18(20(19)27-2)21(25)23-17-8-10-24(11-9-17)14-15-6-4-3-5-7-15/h3-7,12-13,17H,8-11,14H2,1-2H3,(H,23,25) |
| InChIKey | SJQBOYNFPPKBRB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|