C19H19Cl2IN2O — CID 26691477
N-(1-benzylpiperidin-4-yl)-3,5-dichloro-2-iodobenzamide (PubChem CID 26691477) has the molecular formula C19H19Cl2IN2O and a molecular weight of 489.18 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3,5-dichloro-2-iodobenzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3,5-dichloro-2-iodobenzamide |
|---|---|
| PubChem CID | 26691477 |
| Molecular Formula | C19H19Cl2IN2O |
| Molecular Weight | 489.18 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3,5-dichloro-2-iodobenzamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C19H19Cl2IN2O/c20-14-10-16(18(22)17(21)11-14)19(25)23-15-6-8-24(9-7-15)12-13-4-2-1-3-5-13/h1-5,10-11,15H,6-9,12H2,(H,23,25) |
| InChIKey | YHDOLLMIGKNZAX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.18 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|