C28H26ClN3O — CID 86272150
N-(1-benzylpiperidin-4-yl)-7-chloro-2-phenylquinoline-4-carboxamide (PubChem CID 86272150) has the molecular formula C28H26ClN3O and a molecular weight of 455.99 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-7-chloro-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-7-chloro-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 86272150 |
| Molecular Formula | C28H26ClN3O |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-7-chloro-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cc(-c2ccccc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C28H26ClN3O/c29-22-11-12-24-25(18-26(31-27(24)17-22)21-9-5-2-6-10-21)28(33)30-23-13-15-32(16-14-23)19-20-7-3-1-4-8-20/h1-12,17-18,23H,13-16,19H2,(H,30,33) |
| InChIKey | DRLJHULBHQWFFK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |