C26H22ClN3O3 — CID 46539989
2-(4-chlorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]quinoline-4-carboxamide (PubChem CID 46539989) has the molecular formula C26H22ClN3O3 and a molecular weight of 459.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46539989 |
| Molecular Formula | C26H22ClN3O3 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]quinoline-4-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccoc2)CC1)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C26H22ClN3O3/c27-19-7-5-17(6-8-19)24-15-22(21-3-1-2-4-23(21)29-24)25(31)28-20-9-12-30(13-10-20)26(32)18-11-14-33-16-18/h1-8,11,14-16,20H,9-10,12-13H2,(H,28,31) |
| InChIKey | GTJWXBMFFHIIRC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |