C26H22ClN3O2S — CID 60578287
N-[1-[2-(4-chlorophenyl)quinoline-4-carbonyl]piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 60578287) has the molecular formula C26H22ClN3O2S and a molecular weight of 476.00 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)quinoline-4-carbonyl]piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-[2-(4-chlorophenyl)quinoline-4-carbonyl]piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60578287 |
| Molecular Formula | C26H22ClN3O2S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)quinoline-4-carbonyl]piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)CC1)c1ccsc1 |
| InChI | InChI=1S/C26H22ClN3O2S/c27-19-7-5-17(6-8-19)24-15-22(21-3-1-2-4-23(21)29-24)26(32)30-12-9-20(10-13-30)28-25(31)18-11-14-33-16-18/h1-8,11,14-16,20H,9-10,12-13H2,(H,28,31) |
| InChIKey | OLXHZOOBRGIMSZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |