C17H17N3O4S — CID 119182545
6-[4-(thiophene-3-carbonylamino)piperidine-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 119182545) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 6-[4-(thiophene-3-carbonylamino)piperidine-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[4-(thiophene-3-carbonylamino)piperidine-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119182545 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 6-[4-(thiophene-3-carbonylamino)piperidine-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | O=C(NC1CCN(C(=O)c2cccc(C(=O)O)n2)CC1)c1ccsc1 |
| InChI | InChI=1S/C17H17N3O4S/c21-15(11-6-9-25-10-11)18-12-4-7-20(8-5-12)16(22)13-2-1-3-14(19-13)17(23)24/h1-3,6,9-10,12H,4-5,7-8H2,(H,18,21)(H,23,24) |
| InChIKey | CBGWEUVWMNVQMD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |