C18H25N3O2S — CID 119752043
N-[1-(3-aminobicyclo[2.2.1]heptane-2-carbonyl)piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 119752043) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[1-(3-aminobicyclo[2.2.1]heptane-2-carbonyl)piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-(3-aminobicyclo[2.2.1]heptane-2-carbonyl)piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 119752043 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[1-(3-aminobicyclo[2.2.1]heptane-2-carbonyl)piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)N1CCC(NC(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C18H25N3O2S/c19-16-12-2-1-11(9-12)15(16)18(23)21-6-3-14(4-7-21)20-17(22)13-5-8-24-10-13/h5,8,10-12,14-16H,1-4,6-7,9,19H2,(H,20,22) |
| InChIKey | HSYIRKZSOUZJPH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |