C9H12N2OS — CID 43594920
N-(3-aminocyclobutyl)thiophene-3-carboxamide (PubChem CID 43594920) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)thiophene-3-carboxamide.
| Compound Name | N-(3-aminocyclobutyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43594920 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-(3-aminocyclobutyl)thiophene-3-carboxamide |
| SMILES | NC1CC(NC(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C9H12N2OS/c10-7-3-8(4-7)11-9(12)6-1-2-13-5-6/h1-2,5,7-8H,3-4,10H2,(H,11,12) |
| InChIKey | UEEDZPYCXVSUCB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |