C9H11IN2OS — CID 79693813
N-(3-aminocyclobutyl)-5-iodothiophene-3-carboxamide (PubChem CID 79693813) has the molecular formula C9H11IN2OS and a molecular weight of 322.17 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(3-aminocyclobutyl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693813 |
| Molecular Formula | C9H11IN2OS |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | N-(3-aminocyclobutyl)-5-iodothiophene-3-carboxamide |
| SMILES | NC1CC(NC(=O)c2csc(I)c2)C1 |
| InChI | InChI=1S/C9H11IN2OS/c10-8-1-5(4-14-8)9(13)12-7-2-6(11)3-7/h1,4,6-7H,2-3,11H2,(H,12,13) |
| InChIKey | FXTKYBSKOCOVKE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|