C12H17IN2OS — CID 79005771
N-(1,2-dimethylpiperidin-4-yl)-5-iodothiophene-3-carboxamide (PubChem CID 79005771) has the molecular formula C12H17IN2OS and a molecular weight of 364.25 g/mol. Its IUPAC name is N-(1,2-dimethylpiperidin-4-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(1,2-dimethylpiperidin-4-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79005771 |
| Molecular Formula | C12H17IN2OS |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-(1,2-dimethylpiperidin-4-yl)-5-iodothiophene-3-carboxamide |
| SMILES | CC1CC(NC(=O)c2csc(I)c2)CCN1C |
| InChI | InChI=1S/C12H17IN2OS/c1-8-5-10(3-4-15(8)2)14-12(16)9-6-11(13)17-7-9/h6-8,10H,3-5H2,1-2H3,(H,14,16) |
| InChIKey | WTAPONFBMLOSIA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|