C12H15IN2O2S — CID 113233340
N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]acetamide (PubChem CID 113233340) has the molecular formula C12H15IN2O2S and a molecular weight of 378.24 g/mol. Its IUPAC name is N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 113233340 |
| Molecular Formula | C12H15IN2O2S |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C(=O)c2csc(I)c2)CC1 |
| InChI | InChI=1S/C12H15IN2O2S/c1-8(16)14-10-2-4-15(5-3-10)12(17)9-6-11(13)18-7-9/h6-7,10H,2-5H2,1H3,(H,14,16) |
| InChIKey | MDSMVFWRYRCMLM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|