C11H15IN2OS — CID 78949609
[3-(dimethylamino)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone (PubChem CID 78949609) has the molecular formula C11H15IN2OS and a molecular weight of 350.23 g/mol. Its IUPAC name is [3-(dimethylamino)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone.
| Compound Name | [3-(dimethylamino)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 78949609 |
| Molecular Formula | C11H15IN2OS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | [3-(dimethylamino)pyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
| SMILES | CN(C)C1CCN(C(=O)c2csc(I)c2)C1 |
| InChI | InChI=1S/C11H15IN2OS/c1-13(2)9-3-4-14(6-9)11(15)8-5-10(12)16-7-8/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | JAZWGVAHLDYJFU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|