C14H18N2O3S — CID 79692653
3-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 79692653) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79692653 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CN(C)C1CCN(C(=O)c2csc(C=CC(=O)O)c2)C1 |
| InChI | InChI=1S/C14H18N2O3S/c1-15(2)11-5-6-16(8-11)14(19)10-7-12(20-9-10)3-4-13(17)18/h3-4,7,9,11H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | QDLPYXWODFVSQD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|