C11H13IN2O2S — CID 78948632
1-(5-iodothiophene-3-carbonyl)piperidine-4-carboxamide (PubChem CID 78948632) has the molecular formula C11H13IN2O2S and a molecular weight of 364.21 g/mol. Its IUPAC name is 1-(5-iodothiophene-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-iodothiophene-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78948632 |
| Molecular Formula | C11H13IN2O2S |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 1-(5-iodothiophene-3-carbonyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2csc(I)c2)CC1 |
| InChI | InChI=1S/C11H13IN2O2S/c12-9-5-8(6-17-9)11(16)14-3-1-7(2-4-14)10(13)15/h5-7H,1-4H2,(H2,13,15) |
| InChIKey | YJVIUZWEEZHKQT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|