C14H19IN2O2S — CID 78949086
N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]butanamide (PubChem CID 78949086) has the molecular formula C14H19IN2O2S and a molecular weight of 406.29 g/mol. Its IUPAC name is N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]butanamide.
| Compound Name | N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 78949086 |
| Molecular Formula | C14H19IN2O2S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | N-[1-(5-iodothiophene-3-carbonyl)piperidin-4-yl]butanamide |
| SMILES | CCCC(=O)NC1CCN(C(=O)c2csc(I)c2)CC1 |
| InChI | InChI=1S/C14H19IN2O2S/c1-2-3-13(18)16-11-4-6-17(7-5-11)14(19)10-8-12(15)20-9-10/h8-9,11H,2-7H2,1H3,(H,16,18) |
| InChIKey | POLRDAMZFCEMGY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|