C14H12INOS — CID 104693627
N-(2,3-dihydro-1H-inden-2-yl)-5-iodothiophene-3-carboxamide (PubChem CID 104693627) has the molecular formula C14H12INOS and a molecular weight of 369.23 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 104693627 |
| Molecular Formula | C14H12INOS |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-5-iodothiophene-3-carboxamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1csc(I)c1 |
| InChI | InChI=1S/C14H12INOS/c15-13-7-11(8-18-13)14(17)16-12-5-9-3-1-2-4-10(9)6-12/h1-4,7-8,12H,5-6H2,(H,16,17) |
| InChIKey | OJTKCMWLOGMSBF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|