C16H15NOS — CID 107854750
N-(2,3-dihydro-1H-inden-2-yl)-3-sulfanylbenzamide (PubChem CID 107854750) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-3-sulfanylbenzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107854750 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-3-sulfanylbenzamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1cccc(S)c1 |
| InChI | InChI=1S/C16H15NOS/c18-16(13-6-3-7-15(19)10-13)17-14-8-11-4-1-2-5-12(11)9-14/h1-7,10,14,19H,8-9H2,(H,17,18) |
| InChIKey | JCOSGGJOWSIION-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|