C16H15NO2 — CID 104694730
N-(2,3-dihydro-1H-inden-2-yl)-4-hydroxybenzamide (PubChem CID 104694730) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-4-hydroxybenzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 104694730 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-4-hydroxybenzamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H15NO2/c18-15-7-5-11(6-8-15)16(19)17-14-9-12-3-1-2-4-13(12)10-14/h1-8,14,18H,9-10H2,(H,17,19) |
| InChIKey | HAPBKAKTHUMEQV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |