C16H13BrClNO — CID 107853184
4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-2-yl)benzamide (PubChem CID 107853184) has the molecular formula C16H13BrClNO and a molecular weight of 350.64 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-2-yl)benzamide.
| Compound Name | 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-2-yl)benzamide |
|---|---|
| PubChem CID | 107853184 |
| Molecular Formula | C16H13BrClNO |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-2-yl)benzamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C16H13BrClNO/c17-14-6-5-12(9-15(14)18)16(20)19-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13H,7-8H2,(H,19,20) |
| InChIKey | WBPPYZCNWQWRKM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |