C15H19BrClNO — CID 81308376
4-bromo-3-chloro-N-(4,4-dimethylcyclohexyl)benzamide (PubChem CID 81308376) has the molecular formula C15H19BrClNO and a molecular weight of 344.68 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(4,4-dimethylcyclohexyl)benzamide.
| Compound Name | 4-bromo-3-chloro-N-(4,4-dimethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 81308376 |
| Molecular Formula | C15H19BrClNO |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-bromo-3-chloro-N-(4,4-dimethylcyclohexyl)benzamide |
| SMILES | CC1(C)CCC(NC(=O)c2ccc(Br)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H19BrClNO/c1-15(2)7-5-11(6-8-15)18-14(19)10-3-4-12(16)13(17)9-10/h3-4,9,11H,5-8H2,1-2H3,(H,18,19) |
| InChIKey | BYUZBRITNRHCFA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |