C17H17NO3 — CID 103956267
3,4-dihydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide (PubChem CID 103956267) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3,4-dihydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide.
| Compound Name | 3,4-dihydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
|---|---|
| PubChem CID | 103956267 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3,4-dihydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
| SMILES | O=C(NC1CCc2ccccc2C1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H17NO3/c19-15-8-6-13(10-16(15)20)17(21)18-14-7-5-11-3-1-2-4-12(11)9-14/h1-4,6,8,10,14,19-20H,5,7,9H2,(H,18,21) |
| InChIKey | KNEOSZICESNPTH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|