C16H15ClN2O — CID 22318688
6-chloro-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-3-carboxamide (PubChem CID 22318688) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is 6-chloro-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22318688 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 6-chloro-N-(1,2,3,4-tetrahydronaphthalen-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCc2ccccc2C1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H15ClN2O/c17-15-8-6-13(10-18-15)16(20)19-14-7-5-11-3-1-2-4-12(11)9-14/h1-4,6,8,10,14H,5,7,9H2,(H,19,20) |
| InChIKey | MXTBOUSLBHKHEW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|