C17H15Cl2N3O3 — CID 129111810
[5-chloro-6-[(6-chloropyridine-3-carbonyl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid (PubChem CID 129111810) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is [5-chloro-6-[(6-chloropyridine-3-carbonyl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid.
| Compound Name | [5-chloro-6-[(6-chloropyridine-3-carbonyl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid |
|---|---|
| PubChem CID | 129111810 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [5-chloro-6-[(6-chloropyridine-3-carbonyl)amino]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid |
| SMILES | O=C(O)NC1CCc2c(ccc(NC(=O)c3ccc(Cl)nc3)c2Cl)C1 |
| InChI | InChI=1S/C17H15Cl2N3O3/c18-14-6-2-10(8-20-14)16(23)22-13-5-1-9-7-11(21-17(24)25)3-4-12(9)15(13)19/h1-2,5-6,8,11,21H,3-4,7H2,(H,22,23)(H,24,25) |
| InChIKey | ZQFMRNSSFFYABD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|