C12H7ClN4O5 — CID 22668935
6-chloro-N-(2,4-dinitrophenyl)pyridine-3-carboxamide (PubChem CID 22668935) has the molecular formula C12H7ClN4O5 and a molecular weight of 322.66 g/mol. Its IUPAC name is 6-chloro-N-(2,4-dinitrophenyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(2,4-dinitrophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22668935 |
| Molecular Formula | C12H7ClN4O5 |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 6-chloro-N-(2,4-dinitrophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H7ClN4O5/c13-11-4-1-7(6-14-11)12(18)15-9-3-2-8(16(19)20)5-10(9)17(21)22/h1-6H,(H,15,18) |
| InChIKey | TUYSSGYYNPLMAM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|