C10H6N4O5S — CID 63047836
N-(2,4-dinitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 63047836) has the molecular formula C10H6N4O5S and a molecular weight of 294.25 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,4-dinitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63047836 |
| Molecular Formula | C10H6N4O5S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | N-(2,4-dinitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1cscn1 |
| InChI | InChI=1S/C10H6N4O5S/c15-10(8-4-20-5-11-8)12-7-2-1-6(13(16)17)3-9(7)14(18)19/h1-5H,(H,12,15) |
| InChIKey | LRFKIXZGPRXPLL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|