C11H7N3O5S — CID 63021820
3-nitro-4-(1,3-thiazole-4-carbonylamino)benzoic acid (PubChem CID 63021820) has the molecular formula C11H7N3O5S and a molecular weight of 293.26 g/mol. Its IUPAC name is 3-nitro-4-(1,3-thiazole-4-carbonylamino)benzoic acid.
| Compound Name | 3-nitro-4-(1,3-thiazole-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63021820 |
| Molecular Formula | C11H7N3O5S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 3-nitro-4-(1,3-thiazole-4-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cscn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H7N3O5S/c15-10(8-4-20-5-12-8)13-7-2-1-6(11(16)17)3-9(7)14(18)19/h1-5H,(H,13,15)(H,16,17) |
| InChIKey | KVEYORCHEZIWIC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|