C10H6FN3O3S — CID 62044834
N-(2-fluoro-5-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 62044834) has the molecular formula C10H6FN3O3S and a molecular weight of 267.24 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62044834 |
| Molecular Formula | C10H6FN3O3S |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)c1cscn1 |
| InChI | InChI=1S/C10H6FN3O3S/c11-7-2-1-6(14(16)17)3-8(7)13-10(15)9-4-18-5-12-9/h1-5H,(H,13,15) |
| InChIKey | YGCOEYFJHGSNJV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|