C10H5BrF2N2OS — CID 102848003
N-(5-bromo-2,4-difluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 102848003) has the molecular formula C10H5BrF2N2OS and a molecular weight of 319.13 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 102848003 |
| Molecular Formula | C10H5BrF2N2OS |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cc(Br)c(F)cc1F)c1cscn1 |
| InChI | InChI=1S/C10H5BrF2N2OS/c11-5-1-8(7(13)2-6(5)12)15-10(16)9-3-17-4-14-9/h1-4H,(H,15,16) |
| InChIKey | CKZXVUVWCQBSLS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|