C9H5F2N3OS — CID 103097885
N-(2,6-difluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 103097885) has the molecular formula C9H5F2N3OS and a molecular weight of 241.22 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 103097885 |
| Molecular Formula | C9H5F2N3OS |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)nc1F)c1cscn1 |
| InChI | InChI=1S/C9H5F2N3OS/c10-7-2-1-5(8(11)14-7)13-9(15)6-3-16-4-12-6/h1-4H,(H,13,15) |
| InChIKey | ZNLLROCYJWLNOM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|