About N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide
N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 62046847) has the molecular formula C10H7ClN2OS
and a molecular weight of 238.70 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 62046847 |
| Molecular Formula | C10H7ClN2OS |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cscn1 |
| InChI | InChI=1S/C10H7ClN2OS/c11-7-3-1-2-4-8(7)13-10(14)9-5-15-6-12-9/h1-6H,(H,13,14) |
| InChIKey | PSULIJBAVGPMNZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide (CID 62046847) is N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide is O=C(Nc1ccccc1Cl)c1cscn1.
What is the InChIKey of N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is PSULIJBAVGPMNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN2OS/c11-7-3-1-2-4-8(7)13-10(14)9-5-15-6-12-9/h1-6H,(H,13,14).
What are the key properties of N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide?
N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 238.70 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 62046847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).