C10H7ClN2OS — CID 62046847
N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 62046847) has the molecular formula C10H7ClN2OS and a molecular weight of 238.70 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62046847 |
| Molecular Formula | C10H7ClN2OS |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | N-(2-chlorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cscn1 |
| InChI | InChI=1S/C10H7ClN2OS/c11-7-3-1-2-4-8(7)13-10(14)9-5-15-6-12-9/h1-6H,(H,13,14) |
| InChIKey | PSULIJBAVGPMNZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |