C15H17N3OS — CID 62046501
N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 62046501) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62046501 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(2-piperidin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1cscn1 |
| InChI | InChI=1S/C15H17N3OS/c19-15(13-10-20-11-16-13)17-12-6-2-3-7-14(12)18-8-4-1-5-9-18/h2-3,6-7,10-11H,1,4-5,8-9H2,(H,17,19) |
| InChIKey | XPNBGSHOJNOMGT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |