C18H24N4OS — CID 120641148
2-(2-aminoethyl)-N-[2-(azepan-1-yl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 120641148) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-[2-(azepan-1-yl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-[2-(azepan-1-yl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 120641148 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(2-aminoethyl)-N-[2-(azepan-1-yl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | NCCc1nc(C(=O)Nc2ccccc2N2CCCCCC2)cs1 |
| InChI | InChI=1S/C18H24N4OS/c19-10-9-17-20-15(13-24-17)18(23)21-14-7-3-4-8-16(14)22-11-5-1-2-6-12-22/h3-4,7-8,13H,1-2,5-6,9-12,19H2,(H,21,23) |
| InChIKey | TULIUUHYGLQYSD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |