C17H21N3OS — CID 71881060
N-[2-(azepan-1-yl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 71881060) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71881060 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[2-(azepan-1-yl)phenyl]-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)Nc2ccccc2N2CCCCCC2)s1 |
| InChI | InChI=1S/C17H21N3OS/c1-13-18-12-16(22-13)17(21)19-14-8-4-5-9-15(14)20-10-6-2-3-7-11-20/h4-5,8-9,12H,2-3,6-7,10-11H2,1H3,(H,19,21) |
| InChIKey | BQLZXDRJWSNEBS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |