C18H19Cl2N3O — CID 18287671
N-[2-(azepan-1-yl)phenyl]-5,6-dichloropyridine-3-carboxamide (PubChem CID 18287671) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)phenyl]-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)phenyl]-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 18287671 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[2-(azepan-1-yl)phenyl]-5,6-dichloropyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCCCC1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N3O/c19-14-11-13(12-21-17(14)20)18(24)22-15-7-3-4-8-16(15)23-9-5-1-2-6-10-23/h3-4,7-8,11-12H,1-2,5-6,9-10H2,(H,22,24) |
| InChIKey | SNURCMMNMRMJOA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|