C18H17Cl2N3O2 — CID 55776635
5,6-dichloro-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyridine-3-carboxamide (PubChem CID 55776635) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 5,6-dichloro-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55776635 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 5,6-dichloro-N-[3-methyl-2-(pyrrolidine-1-carbonyl)phenyl]pyridine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cnc(Cl)c(Cl)c2)c1C(=O)N1CCCC1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-11-5-4-6-14(15(11)18(25)23-7-2-3-8-23)22-17(24)12-9-13(19)16(20)21-10-12/h4-6,9-10H,2-3,7-8H2,1H3,(H,22,24) |
| InChIKey | VQSKVBVILDHNTD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|