C17H16F3N3O — CID 33171812
N-(2-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 33171812) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 33171812 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-(2-pyrrolidin-1-ylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C17H16F3N3O/c18-17(19,20)15-8-7-12(11-21-15)16(24)22-13-5-1-2-6-14(13)23-9-3-4-10-23/h1-2,5-8,11H,3-4,9-10H2,(H,22,24) |
| InChIKey | DZFSGZSMIKTBOQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |