C11H9ClN2O2S — CID 55143825
N-(2-chloro-5-methoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 55143825) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55143825 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(Cl)c(NC(=O)c2cscn2)c1 |
| InChI | InChI=1S/C11H9ClN2O2S/c1-16-7-2-3-8(12)9(4-7)14-11(15)10-5-17-6-13-10/h2-6H,1H3,(H,14,15) |
| InChIKey | NZCHJXUWWQAXTF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |