C14H12ClNO4 — CID 107722765
N-(2-chloro-5-methoxyphenyl)-2,5-dihydroxybenzamide (PubChem CID 107722765) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107722765 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-2,5-dihydroxybenzamide |
| SMILES | COc1ccc(Cl)c(NC(=O)c2cc(O)ccc2O)c1 |
| InChI | InChI=1S/C14H12ClNO4/c1-20-9-3-4-11(15)12(7-9)16-14(19)10-6-8(17)2-5-13(10)18/h2-7,17-18H,1H3,(H,16,19) |
| InChIKey | SNJVPPCICXLTAU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|