C14H13ClN2O3 — CID 43548769
N-(5-amino-2-chlorophenyl)-2-hydroxy-4-methoxybenzamide (PubChem CID 43548769) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is N-(5-amino-2-chlorophenyl)-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-(5-amino-2-chlorophenyl)-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 43548769 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-(5-amino-2-chlorophenyl)-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(N)ccc2Cl)c(O)c1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-20-9-3-4-10(13(18)7-9)14(19)17-12-6-8(16)2-5-11(12)15/h2-7,18H,16H2,1H3,(H,17,19) |
| InChIKey | GHWHMEDJIGEDPY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|