C14H11Cl3N2O2 — CID 82810855
4-amino-3,5-dichloro-N-(2-chloro-5-methoxyphenyl)benzamide (PubChem CID 82810855) has the molecular formula C14H11Cl3N2O2 and a molecular weight of 345.61 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(2-chloro-5-methoxyphenyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(2-chloro-5-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 82810855 |
| Molecular Formula | C14H11Cl3N2O2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(2-chloro-5-methoxyphenyl)benzamide |
| SMILES | COc1ccc(Cl)c(NC(=O)c2cc(Cl)c(N)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H11Cl3N2O2/c1-21-8-2-3-9(15)12(6-8)19-14(20)7-4-10(16)13(18)11(17)5-7/h2-6H,18H2,1H3,(H,19,20) |
| InChIKey | PUQSIWJJXNJIOM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|