C12H12ClN3O3S2 — CID 63047654
N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 63047654) has the molecular formula C12H12ClN3O3S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63047654 |
| Molecular Formula | C12H12ClN3O3S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(NC(=O)c2cscn2)c1 |
| InChI | InChI=1S/C12H12ClN3O3S2/c1-16(2)21(18,19)8-3-4-9(13)10(5-8)15-12(17)11-6-20-7-14-11/h3-7H,1-2H3,(H,15,17) |
| InChIKey | RDTGGURQCTWHOL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |