C13H21ClN3O3S+ — CID 8867441
[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]-propan-2-ylazanium (PubChem CID 8867441) has the molecular formula C13H21ClN3O3S+ and a molecular weight of 334.85 g/mol. Its IUPAC name is [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]-propan-2-ylazanium.
| Compound Name | [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 8867441 |
| Molecular Formula | C13H21ClN3O3S+ |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]CC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C13H20ClN3O3S/c1-9(2)15-8-13(18)16-12-7-10(5-6-11(12)14)21(19,20)17(3)4/h5-7,9,15H,8H2,1-4H3,(H,16,18)/p+1 |
| InChIKey | PLZPECYNORDKRP-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |